C13H15F3INO — CID 107848024
2,3,4-trifluoro-N-(6-iodohexyl)benzamide (PubChem CID 107848024) has the molecular formula C13H15F3INO and a molecular weight of 385.17 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-(6-iodohexyl)benzamide.
| Compound Name | 2,3,4-trifluoro-N-(6-iodohexyl)benzamide |
|---|---|
| PubChem CID | 107848024 |
| Molecular Formula | C13H15F3INO |
| Molecular Weight | 385.17 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | 2,3,4-trifluoro-N-(6-iodohexyl)benzamide |
| SMILES | O=C(NCCCCCCI)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H15F3INO/c14-10-6-5-9(11(15)12(10)16)13(19)18-8-4-2-1-3-7-17/h5-6H,1-4,7-8H2,(H,18,19) |
| InChIKey | MBKRWWSEVFXVRD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.17 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|