C12H11F3N2O — CID 79749440
N-(4-cyanobutyl)-2,3,4-trifluorobenzamide (PubChem CID 79749440) has the molecular formula C12H11F3N2O and a molecular weight of 256.23 g/mol. Its IUPAC name is N-(4-cyanobutyl)-2,3,4-trifluorobenzamide.
| Compound Name | N-(4-cyanobutyl)-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 79749440 |
| Molecular Formula | C12H11F3N2O |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | N-(4-cyanobutyl)-2,3,4-trifluorobenzamide |
| SMILES | N#CCCCCNC(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H11F3N2O/c13-9-5-4-8(10(14)11(9)15)12(18)17-7-3-1-2-6-16/h4-5H,1-3,7H2,(H,17,18) |
| InChIKey | BEVZOEPRUGFDAF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|