C20H26N4O2 — CID 11783188
1-N,4-N-bis(5-cyanopentyl)benzene-1,4-dicarboxamide (PubChem CID 11783188) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-N,4-N-bis(5-cyanopentyl)benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(5-cyanopentyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 11783188 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 1-N,4-N-bis(5-cyanopentyl)benzene-1,4-dicarboxamide |
| SMILES | N#CCCCCCNC(=O)c1ccc(C(=O)NCCCCCC#N)cc1 |
| InChI | InChI=1S/C20H26N4O2/c21-13-5-1-3-7-15-23-19(25)17-9-11-18(12-10-17)20(26)24-16-8-4-2-6-14-22/h9-12H,1-8,15-16H2,(H,23,25)(H,24,26) |
| InChIKey | RSWYOAUXEUZUOP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|