C12H12F2N2O — CID 63284826
N-(4-cyanobutyl)-3,4-difluorobenzamide (PubChem CID 63284826) has the molecular formula C12H12F2N2O and a molecular weight of 238.24 g/mol. Its IUPAC name is N-(4-cyanobutyl)-3,4-difluorobenzamide.
| Compound Name | N-(4-cyanobutyl)-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 63284826 |
| Molecular Formula | C12H12F2N2O |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | N-(4-cyanobutyl)-3,4-difluorobenzamide |
| SMILES | N#CCCCCNC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H12F2N2O/c13-10-5-4-9(8-11(10)14)12(17)16-7-3-1-2-6-15/h4-5,8H,1-3,7H2,(H,16,17) |
| InChIKey | JFMDNUAZATUPBC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|