C14H19F2NO — CID 91717416
3,4-difluoro-N-heptylbenzamide (PubChem CID 91717416) has the molecular formula C14H19F2NO and a molecular weight of 255.31 g/mol. Its IUPAC name is 3,4-difluoro-N-heptylbenzamide.
| Compound Name | 3,4-difluoro-N-heptylbenzamide |
|---|---|
| PubChem CID | 91717416 |
| Molecular Formula | C14H19F2NO |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 3,4-difluoro-N-heptylbenzamide |
| SMILES | CCCCCCCNC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H19F2NO/c1-2-3-4-5-6-9-17-14(18)11-7-8-12(15)13(16)10-11/h7-8,10H,2-6,9H2,1H3,(H,17,18) |
| InChIKey | MRMMODXOOVRURO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|