C19H33N3O — CID 22411166
3,4-diamino-N-dodecylbenzamide (PubChem CID 22411166) has the molecular formula C19H33N3O and a molecular weight of 319.49 g/mol. Its IUPAC name is 3,4-diamino-N-dodecylbenzamide.
| Compound Name | 3,4-diamino-N-dodecylbenzamide |
|---|---|
| PubChem CID | 22411166 |
| Molecular Formula | C19H33N3O |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.26 |
| IUPAC Name | 3,4-diamino-N-dodecylbenzamide |
| SMILES | CCCCCCCCCCCCNC(=O)c1ccc(N)c(N)c1 |
| InChI | InChI=1S/C19H33N3O/c1-2-3-4-5-6-7-8-9-10-11-14-22-19(23)16-12-13-17(20)18(21)15-16/h12-13,15H,2-11,14,20-21H2,1H3,(H,22,23) |
| InChIKey | SUBUGCRLSLFCJQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|