C18H23NO — CID 91722099
N-heptylnaphthalene-2-carboxamide (PubChem CID 91722099) has the molecular formula C18H23NO and a molecular weight of 269.39 g/mol. Its IUPAC name is N-heptylnaphthalene-2-carboxamide.
| Compound Name | N-heptylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 91722099 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | N-heptylnaphthalene-2-carboxamide |
| SMILES | CCCCCCCNC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H23NO/c1-2-3-4-5-8-13-19-18(20)17-12-11-15-9-6-7-10-16(15)14-17/h6-7,9-12,14H,2-5,8,13H2,1H3,(H,19,20) |
| InChIKey | WKOCNPBMHRKZNP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|