C17H19NO3 — CID 42598707
methyl 5-(naphthalene-2-carbonylamino)pentanoate (PubChem CID 42598707) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is methyl 5-(naphthalene-2-carbonylamino)pentanoate.
| Compound Name | methyl 5-(naphthalene-2-carbonylamino)pentanoate |
|---|---|
| PubChem CID | 42598707 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | methyl 5-(naphthalene-2-carbonylamino)pentanoate |
| SMILES | COC(=O)CCCCNC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H19NO3/c1-21-16(19)8-4-5-11-18-17(20)15-10-9-13-6-2-3-7-14(13)12-15/h2-3,6-7,9-10,12H,4-5,8,11H2,1H3,(H,18,20) |
| InChIKey | PNWRGRFFDRDLBS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|