C14H16N2O — CID 24691516
N-(3-aminopropyl)naphthalene-2-carboxamide (PubChem CID 24691516) has the molecular formula C14H16N2O and a molecular weight of 228.30 g/mol. Its IUPAC name is N-(3-aminopropyl)naphthalene-2-carboxamide.
| Compound Name | N-(3-aminopropyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 24691516 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | N-(3-aminopropyl)naphthalene-2-carboxamide |
| SMILES | NCCCNC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H16N2O/c15-8-3-9-16-14(17)13-7-6-11-4-1-2-5-12(11)10-13/h1-2,4-7,10H,3,8-9,15H2,(H,16,17) |
| InChIKey | ZUFSXRQAGVDIJE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|