C16H19NO — CID 91722098
N-pentylnaphthalene-2-carboxamide (PubChem CID 91722098) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is N-pentylnaphthalene-2-carboxamide.
| Compound Name | N-pentylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 91722098 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | N-pentylnaphthalene-2-carboxamide |
| SMILES | CCCCCNC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H19NO/c1-2-3-6-11-17-16(18)15-10-9-13-7-4-5-8-14(13)12-15/h4-5,7-10,12H,2-3,6,11H2,1H3,(H,17,18) |
| InChIKey | YREDFZUBMGMFLJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|