C13H18F2N2O — CID 63183966
3,5-difluoro-4-(methylamino)-N-pentylbenzamide (PubChem CID 63183966) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is 3,5-difluoro-4-(methylamino)-N-pentylbenzamide.
| Compound Name | 3,5-difluoro-4-(methylamino)-N-pentylbenzamide |
|---|---|
| PubChem CID | 63183966 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 3,5-difluoro-4-(methylamino)-N-pentylbenzamide |
| SMILES | CCCCCNC(=O)c1cc(F)c(NC)c(F)c1 |
| InChI | InChI=1S/C13H18F2N2O/c1-3-4-5-6-17-13(18)9-7-10(14)12(16-2)11(15)8-9/h7-8,16H,3-6H2,1-2H3,(H,17,18) |
| InChIKey | ASSOIIIAKIUEGP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|