C16H24F2N2O — CID 106027843
3,5-difluoro-4-(methylamino)-N-octan-4-ylbenzamide (PubChem CID 106027843) has the molecular formula C16H24F2N2O and a molecular weight of 298.38 g/mol. Its IUPAC name is 3,5-difluoro-4-(methylamino)-N-octan-4-ylbenzamide.
| Compound Name | 3,5-difluoro-4-(methylamino)-N-octan-4-ylbenzamide |
|---|---|
| PubChem CID | 106027843 |
| Molecular Formula | C16H24F2N2O |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 3,5-difluoro-4-(methylamino)-N-octan-4-ylbenzamide |
| SMILES | CCCCC(CCC)NC(=O)c1cc(F)c(NC)c(F)c1 |
| InChI | InChI=1S/C16H24F2N2O/c1-4-6-8-12(7-5-2)20-16(21)11-9-13(17)15(19-3)14(18)10-11/h9-10,12,19H,4-8H2,1-3H3,(H,20,21) |
| InChIKey | PJMUIHZSSBGTFU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |