C30H51N3O3 — CID 70884493
1-N,3-N,5-N-tri(heptan-4-yl)benzene-1,3,5-tricarboxamide (PubChem CID 70884493) has the molecular formula C30H51N3O3 and a molecular weight of 501.76 g/mol. Its IUPAC name is 1-N,3-N,5-N-tri(heptan-4-yl)benzene-1,3,5-tricarboxamide.
| Compound Name | 1-N,3-N,5-N-tri(heptan-4-yl)benzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 70884493 |
| Molecular Formula | C30H51N3O3 |
| Molecular Weight | 501.76 g/mol |
| Exact Mass | 501.39 |
| IUPAC Name | 1-N,3-N,5-N-tri(heptan-4-yl)benzene-1,3,5-tricarboxamide |
| SMILES | CCCC(CCC)NC(=O)c1cc(C(=O)NC(CCC)CCC)cc(C(=O)NC(CCC)CCC)c1 |
| InChI | InChI=1S/C30H51N3O3/c1-7-13-25(14-8-2)31-28(34)22-19-23(29(35)32-26(15-9-3)16-10-4)21-24(20-22)30(36)33-27(17-11-5)18-12-6/h19-21,25-27H,7-18H2,1-6H3,(H,31,34)(H,32,35)(H,33,36) |
| InChIKey | UVBQJRILQRTANM-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.76 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |