C18H29NO — CID 138525805
4-tert-butyl-N-heptan-4-ylbenzamide (PubChem CID 138525805) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is 4-tert-butyl-N-heptan-4-ylbenzamide.
| Compound Name | 4-tert-butyl-N-heptan-4-ylbenzamide |
|---|---|
| PubChem CID | 138525805 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | 4-tert-butyl-N-heptan-4-ylbenzamide |
| SMILES | CCCC(CCC)NC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H29NO/c1-6-8-16(9-7-2)19-17(20)14-10-12-15(13-11-14)18(3,4)5/h10-13,16H,6-9H2,1-5H3,(H,19,20) |
| InChIKey | GOZAQLLXADGRMH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |