C21H34N2O2 — CID 30481179
4-tert-butyl-N-[(2R)-3-methyl-1-oxo-1-[[(2R)-pentan-2-yl]amino]butan-2-yl]benzamide (PubChem CID 30481179) has the molecular formula C21H34N2O2 and a molecular weight of 346.51 g/mol. Its IUPAC name is 4-tert-butyl-N-[(2R)-3-methyl-1-oxo-1-[[(2R)-pentan-2-yl]amino]butan-2-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[(2R)-3-methyl-1-oxo-1-[[(2R)-pentan-2-yl]amino]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 30481179 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | 4-tert-butyl-N-[(2R)-3-methyl-1-oxo-1-[[(2R)-pentan-2-yl]amino]butan-2-yl]benzamide |
| SMILES | CCC[C@@H](C)NC(=O)[C@H](NC(=O)c1ccc(C(C)(C)C)cc1)C(C)C |
| InChI | InChI=1S/C21H34N2O2/c1-8-9-15(4)22-20(25)18(14(2)3)23-19(24)16-10-12-17(13-11-16)21(5,6)7/h10-15,18H,8-9H2,1-7H3,(H,22,25)(H,23,24)/t15-,18-/m1/s1 |
| InChIKey | PFVJIODFSGCADG-CRAIPNDOSA-N |
| XLogP | 4.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |