C20H30N2O4 — CID 119237337
3-[[2-[(4-tert-butylbenzoyl)amino]-3-methylbutanoyl]amino]-2-methylpropanoic acid (PubChem CID 119237337) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is 3-[[2-[(4-tert-butylbenzoyl)amino]-3-methylbutanoyl]amino]-2-methylpropanoic acid.
| Compound Name | 3-[[2-[(4-tert-butylbenzoyl)amino]-3-methylbutanoyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 119237337 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 3-[[2-[(4-tert-butylbenzoyl)amino]-3-methylbutanoyl]amino]-2-methylpropanoic acid |
| SMILES | CC(CNC(=O)C(NC(=O)c1ccc(C(C)(C)C)cc1)C(C)C)C(=O)O |
| InChI | InChI=1S/C20H30N2O4/c1-12(2)16(18(24)21-11-13(3)19(25)26)22-17(23)14-7-9-15(10-8-14)20(4,5)6/h7-10,12-13,16H,11H2,1-6H3,(H,21,24)(H,22,23)(H,25,26) |
| InChIKey | JSUCAPPOLWSTQF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |