C19H27FN2O4 — CID 119252939
2-[[[2-[(4-fluorobenzoyl)amino]-3-methylbutanoyl]amino]methyl]-4-methylpentanoic acid (PubChem CID 119252939) has the molecular formula C19H27FN2O4 and a molecular weight of 366.43 g/mol. Its IUPAC name is 2-[[[2-[(4-fluorobenzoyl)amino]-3-methylbutanoyl]amino]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[[2-[(4-fluorobenzoyl)amino]-3-methylbutanoyl]amino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119252939 |
| Molecular Formula | C19H27FN2O4 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 2-[[[2-[(4-fluorobenzoyl)amino]-3-methylbutanoyl]amino]methyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(CNC(=O)C(NC(=O)c1ccc(F)cc1)C(C)C)C(=O)O |
| InChI | InChI=1S/C19H27FN2O4/c1-11(2)9-14(19(25)26)10-21-18(24)16(12(3)4)22-17(23)13-5-7-15(20)8-6-13/h5-8,11-12,14,16H,9-10H2,1-4H3,(H,21,24)(H,22,23)(H,25,26) |
| InChIKey | WBRAGODYMDOWRC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |