C17H25FN2O2 — CID 4811350
4-fluoro-N-[3-methyl-1-oxo-1-(pentylamino)butan-2-yl]benzamide (PubChem CID 4811350) has the molecular formula C17H25FN2O2 and a molecular weight of 308.40 g/mol. Its IUPAC name is 4-fluoro-N-[3-methyl-1-oxo-1-(pentylamino)butan-2-yl]benzamide.
| Compound Name | 4-fluoro-N-[3-methyl-1-oxo-1-(pentylamino)butan-2-yl]benzamide |
|---|---|
| PubChem CID | 4811350 |
| Molecular Formula | C17H25FN2O2 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 4-fluoro-N-[3-methyl-1-oxo-1-(pentylamino)butan-2-yl]benzamide |
| SMILES | CCCCCNC(=O)C(NC(=O)c1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C17H25FN2O2/c1-4-5-6-11-19-17(22)15(12(2)3)20-16(21)13-7-9-14(18)10-8-13/h7-10,12,15H,4-6,11H2,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | SSVZJYVNLMONEI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|