C16H24FN3O2 — CID 119431360
4-fluoro-N-[3-methyl-1-[3-(methylamino)propylamino]-1-oxobutan-2-yl]benzamide (PubChem CID 119431360) has the molecular formula C16H24FN3O2 and a molecular weight of 309.38 g/mol. Its IUPAC name is 4-fluoro-N-[3-methyl-1-[3-(methylamino)propylamino]-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-fluoro-N-[3-methyl-1-[3-(methylamino)propylamino]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 119431360 |
| Molecular Formula | C16H24FN3O2 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 4-fluoro-N-[3-methyl-1-[3-(methylamino)propylamino]-1-oxobutan-2-yl]benzamide |
| SMILES | CNCCCNC(=O)C(NC(=O)c1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C16H24FN3O2/c1-11(2)14(16(22)19-10-4-9-18-3)20-15(21)12-5-7-13(17)8-6-12/h5-8,11,14,18H,4,9-10H2,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | SDGPNMCSTUNRIS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|