C25H32ClN3O3 — CID 55659461
N-[2-[[2-[(4-tert-butylbenzoyl)amino]-3-methylbutanoyl]amino]ethyl]-2-chlorobenzamide (PubChem CID 55659461) has the molecular formula C25H32ClN3O3 and a molecular weight of 458.00 g/mol. Its IUPAC name is N-[2-[[2-[(4-tert-butylbenzoyl)amino]-3-methylbutanoyl]amino]ethyl]-2-chlorobenzamide.
| Compound Name | N-[2-[[2-[(4-tert-butylbenzoyl)amino]-3-methylbutanoyl]amino]ethyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 55659461 |
| Molecular Formula | C25H32ClN3O3 |
| Molecular Weight | 458.00 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | N-[2-[[2-[(4-tert-butylbenzoyl)amino]-3-methylbutanoyl]amino]ethyl]-2-chlorobenzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(C(C)(C)C)cc1)C(=O)NCCNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C25H32ClN3O3/c1-16(2)21(29-22(30)17-10-12-18(13-11-17)25(3,4)5)24(32)28-15-14-27-23(31)19-8-6-7-9-20(19)26/h6-13,16,21H,14-15H2,1-5H3,(H,27,31)(H,28,32)(H,29,30) |
| InChIKey | JQGMSQQZSXUUAQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.00 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|