C21H23Cl2N3O3 — CID 134046490
N-[1-(2-benzamidoethylamino)-3-methyl-1-oxobutan-2-yl]-2,4-dichlorobenzamide (PubChem CID 134046490) has the molecular formula C21H23Cl2N3O3 and a molecular weight of 436.34 g/mol. Its IUPAC name is N-[1-(2-benzamidoethylamino)-3-methyl-1-oxobutan-2-yl]-2,4-dichlorobenzamide.
| Compound Name | N-[1-(2-benzamidoethylamino)-3-methyl-1-oxobutan-2-yl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 134046490 |
| Molecular Formula | C21H23Cl2N3O3 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | N-[1-(2-benzamidoethylamino)-3-methyl-1-oxobutan-2-yl]-2,4-dichlorobenzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(Cl)cc1Cl)C(=O)NCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H23Cl2N3O3/c1-13(2)18(26-20(28)16-9-8-15(22)12-17(16)23)21(29)25-11-10-24-19(27)14-6-4-3-5-7-14/h3-9,12-13,18H,10-11H2,1-2H3,(H,24,27)(H,25,29)(H,26,28) |
| InChIKey | WNTPWYSMCMVJMV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|