C23H19Cl2N3O3 — CID 121063142
N-[4-(2-benzamidoethylcarbamoyl)phenyl]-2,4-dichlorobenzamide (PubChem CID 121063142) has the molecular formula C23H19Cl2N3O3 and a molecular weight of 456.33 g/mol. Its IUPAC name is N-[4-(2-benzamidoethylcarbamoyl)phenyl]-2,4-dichlorobenzamide.
| Compound Name | N-[4-(2-benzamidoethylcarbamoyl)phenyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 121063142 |
| Molecular Formula | C23H19Cl2N3O3 |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | N-[4-(2-benzamidoethylcarbamoyl)phenyl]-2,4-dichlorobenzamide |
| SMILES | O=C(NCCNC(=O)c1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H19Cl2N3O3/c24-17-8-11-19(20(25)14-17)23(31)28-18-9-6-16(7-10-18)22(30)27-13-12-26-21(29)15-4-2-1-3-5-15/h1-11,14H,12-13H2,(H,26,29)(H,27,30)(H,28,31) |
| InChIKey | IHDQJKMFPCRWPH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|