C21H16Cl2N2O2 — CID 1237676
N-[4-(benzylcarbamoyl)phenyl]-2,4-dichlorobenzamide (PubChem CID 1237676) has the molecular formula C21H16Cl2N2O2 and a molecular weight of 399.28 g/mol. Its IUPAC name is N-[4-(benzylcarbamoyl)phenyl]-2,4-dichlorobenzamide.
| Compound Name | N-[4-(benzylcarbamoyl)phenyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 1237676 |
| Molecular Formula | C21H16Cl2N2O2 |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | N-[4-(benzylcarbamoyl)phenyl]-2,4-dichlorobenzamide |
| SMILES | O=C(NCc1ccccc1)c1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C21H16Cl2N2O2/c22-16-8-11-18(19(23)12-16)21(27)25-17-9-6-15(7-10-17)20(26)24-13-14-4-2-1-3-5-14/h1-12H,13H2,(H,24,26)(H,25,27) |
| InChIKey | YJFNTTORWGUCFO-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |