C13H9Cl2NOS — CID 143459356
2,4-dichloro-N-(4-sulfanylphenyl)benzamide (PubChem CID 143459356) has the molecular formula C13H9Cl2NOS and a molecular weight of 298.19 g/mol. Its IUPAC name is 2,4-dichloro-N-(4-sulfanylphenyl)benzamide.
| Compound Name | 2,4-dichloro-N-(4-sulfanylphenyl)benzamide |
|---|---|
| PubChem CID | 143459356 |
| Molecular Formula | C13H9Cl2NOS |
| Molecular Weight | 298.19 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | 2,4-dichloro-N-(4-sulfanylphenyl)benzamide |
| SMILES | O=C(Nc1ccc(S)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H9Cl2NOS/c14-8-1-6-11(12(15)7-8)13(17)16-9-2-4-10(18)5-3-9/h1-7,18H,(H,16,17) |
| InChIKey | WUISHFMKFDYZMK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.19 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|