C15H9Cl2F3N2O2 — CID 9203694
2,4-dichloro-N-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]benzamide (PubChem CID 9203694) has the molecular formula C15H9Cl2F3N2O2 and a molecular weight of 377.15 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 9203694 |
| Molecular Formula | C15H9Cl2F3N2O2 |
| Molecular Weight | 377.15 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | 2,4-dichloro-N-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(NC(=O)C(F)(F)F)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H9Cl2F3N2O2/c16-8-1-6-11(12(17)7-8)13(23)21-9-2-4-10(5-3-9)22-14(24)15(18,19)20/h1-7H,(H,21,23)(H,22,24) |
| InChIKey | FGACLPVVPMLGFG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.15 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |