C19H16Cl2F3N3O2 — CID 17050371
2,4-dichloro-N-[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]benzamide (PubChem CID 17050371) has the molecular formula C19H16Cl2F3N3O2 and a molecular weight of 446.26 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 17050371 |
| Molecular Formula | C19H16Cl2F3N3O2 |
| Molecular Weight | 446.26 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | 2,4-dichloro-N-[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)C(F)(F)F)CC2)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H16Cl2F3N3O2/c20-12-1-6-15(16(21)11-12)17(28)25-13-2-4-14(5-3-13)26-7-9-27(10-8-26)18(29)19(22,23)24/h1-6,11H,7-10H2,(H,25,28) |
| InChIKey | PXBHAAUTVIJFHT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.26 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|