C23H18Cl2F3N3O3 — CID 17358177
5-(3,4-dichlorophenyl)-N-[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]furan-2-carboxamide (PubChem CID 17358177) has the molecular formula C23H18Cl2F3N3O3 and a molecular weight of 512.32 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-N-[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]furan-2-carboxamide.
| Compound Name | 5-(3,4-dichlorophenyl)-N-[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17358177 |
| Molecular Formula | C23H18Cl2F3N3O3 |
| Molecular Weight | 512.32 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-N-[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)C(F)(F)F)CC2)cc1)c1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C23H18Cl2F3N3O3/c24-17-6-1-14(13-18(17)25)19-7-8-20(34-19)21(32)29-15-2-4-16(5-3-15)30-9-11-31(12-10-30)22(33)23(26,27)28/h1-8,13H,9-12H2,(H,29,32) |
| InChIKey | UHXNHWBYBNVVBP-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.32 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|