C24H20ClF3N4O3S — CID 43914921
5-(4-chlorophenyl)-N-[[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 43914921) has the molecular formula C24H20ClF3N4O3S and a molecular weight of 536.96 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-[[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-[[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 43914921 |
| Molecular Formula | C24H20ClF3N4O3S |
| Molecular Weight | 536.96 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | 5-(4-chlorophenyl)-N-[[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCN(C(=O)C(F)(F)F)CC2)cc1)c1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C24H20ClF3N4O3S/c25-16-3-1-15(2-4-16)19-9-10-20(35-19)21(33)30-23(36)29-17-5-7-18(8-6-17)31-11-13-32(14-12-31)22(34)24(26,27)28/h1-10H,11-14H2,(H2,29,30,33,36) |
| InChIKey | GRNBXNXWSRDCIA-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.96 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|