C29H26Cl2N4O2S — CID 17318215
N-[[4-(4-benzylpiperazin-1-yl)phenyl]carbamothioyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide (PubChem CID 17318215) has the molecular formula C29H26Cl2N4O2S and a molecular weight of 565.53 g/mol. Its IUPAC name is N-[[4-(4-benzylpiperazin-1-yl)phenyl]carbamothioyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-[[4-(4-benzylpiperazin-1-yl)phenyl]carbamothioyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17318215 |
| Molecular Formula | C29H26Cl2N4O2S |
| Molecular Weight | 565.53 g/mol |
| Exact Mass | 564.12 |
| IUPAC Name | N-[[4-(4-benzylpiperazin-1-yl)phenyl]carbamothioyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCN(Cc3ccccc3)CC2)cc1)c1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C29H26Cl2N4O2S/c30-24-11-6-21(18-25(24)31)26-12-13-27(37-26)28(36)33-29(38)32-22-7-9-23(10-8-22)35-16-14-34(15-17-35)19-20-4-2-1-3-5-20/h1-13,18H,14-17,19H2,(H2,32,33,36,38) |
| InChIKey | AIYVSXGIGWLQHO-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 60.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.53 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|