C27H29ClN4OS — CID 17116309
N-[[4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-4-ethylbenzamide (PubChem CID 17116309) has the molecular formula C27H29ClN4OS and a molecular weight of 493.08 g/mol. Its IUPAC name is N-[[4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-4-ethylbenzamide.
| Compound Name | N-[[4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-4-ethylbenzamide |
|---|---|
| PubChem CID | 17116309 |
| Molecular Formula | C27H29ClN4OS |
| Molecular Weight | 493.08 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | N-[[4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-4-ethylbenzamide |
| SMILES | CCc1ccc(C(=O)NC(=S)Nc2ccc(N3CCN(Cc4ccccc4Cl)CC3)cc2)cc1 |
| InChI | InChI=1S/C27H29ClN4OS/c1-2-20-7-9-21(10-8-20)26(33)30-27(34)29-23-11-13-24(14-12-23)32-17-15-31(16-18-32)19-22-5-3-4-6-25(22)28/h3-14H,2,15-19H2,1H3,(H2,29,30,33,34) |
| InChIKey | ADUUWRPYERTKKM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.08 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|