C32H31FN4O2S — CID 17318170
N-[[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-4-phenylmethoxybenzamide (PubChem CID 17318170) has the molecular formula C32H31FN4O2S and a molecular weight of 554.69 g/mol. Its IUPAC name is N-[[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-4-phenylmethoxybenzamide.
| Compound Name | N-[[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 17318170 |
| Molecular Formula | C32H31FN4O2S |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | N-[[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-4-phenylmethoxybenzamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCN(Cc3ccccc3F)CC2)cc1)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C32H31FN4O2S/c33-30-9-5-4-8-26(30)22-36-18-20-37(21-19-36)28-14-12-27(13-15-28)34-32(40)35-31(38)25-10-16-29(17-11-25)39-23-24-6-2-1-3-7-24/h1-17H,18-23H2,(H2,34,35,38,40) |
| InChIKey | HUNJFHORDTVLRF-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|