C26H26FN5O4S — CID 17318148
N-[[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-4-methoxy-3-nitrobenzamide (PubChem CID 17318148) has the molecular formula C26H26FN5O4S and a molecular weight of 523.59 g/mol. Its IUPAC name is N-[[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-4-methoxy-3-nitrobenzamide.
| Compound Name | N-[[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-4-methoxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 17318148 |
| Molecular Formula | C26H26FN5O4S |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | N-[[4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]phenyl]carbamothioyl]-4-methoxy-3-nitrobenzamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2ccc(N3CCN(Cc4ccccc4F)CC3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H26FN5O4S/c1-36-24-11-6-18(16-23(24)32(34)35)25(33)29-26(37)28-20-7-9-21(10-8-20)31-14-12-30(13-15-31)17-19-4-2-3-5-22(19)27/h2-11,16H,12-15,17H2,1H3,(H2,28,29,33,37) |
| InChIKey | ARHBOHVIEMIKFK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|