C27H27N5O5S — CID 4501583
4-methoxy-N-[[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-3-nitrobenzamide (PubChem CID 4501583) has the molecular formula C27H27N5O5S and a molecular weight of 533.61 g/mol. Its IUPAC name is 4-methoxy-N-[[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-3-nitrobenzamide.
| Compound Name | 4-methoxy-N-[[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 4501583 |
| Molecular Formula | C27H27N5O5S |
| Molecular Weight | 533.61 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | 4-methoxy-N-[[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-3-nitrobenzamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2ccc(N3CCN(C(=O)c4ccccc4C)CC3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H27N5O5S/c1-18-5-3-4-6-22(18)26(34)31-15-13-30(14-16-31)21-10-8-20(9-11-21)28-27(38)29-25(33)19-7-12-24(37-2)23(17-19)32(35)36/h3-12,17H,13-16H2,1-2H3,(H2,28,29,33,38) |
| InChIKey | YBFUVZHIMQJJHF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 117.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.61 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|