C26H25BrN4O2S — CID 4501591
2-bromo-N-[[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide (PubChem CID 4501591) has the molecular formula C26H25BrN4O2S and a molecular weight of 537.48 g/mol. Its IUPAC name is 2-bromo-N-[[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide.
| Compound Name | 2-bromo-N-[[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4501591 |
| Molecular Formula | C26H25BrN4O2S |
| Molecular Weight | 537.48 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | 2-bromo-N-[[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide |
| SMILES | Cc1ccccc1C(=O)N1CCN(c2ccc(NC(=S)NC(=O)c3ccccc3Br)cc2)CC1 |
| InChI | InChI=1S/C26H25BrN4O2S/c1-18-6-2-3-7-21(18)25(33)31-16-14-30(15-17-31)20-12-10-19(11-13-20)28-26(34)29-24(32)22-8-4-5-9-23(22)27/h2-13H,14-17H2,1H3,(H2,28,29,32,34) |
| InChIKey | SNWJVUZVPOSTAQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.48 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|