C28H27ClN4O2S — CID 17317851
(E)-3-(4-chlorophenyl)-N-[[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]prop-2-enamide (PubChem CID 17317851) has the molecular formula C28H27ClN4O2S and a molecular weight of 519.07 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-[[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-[[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17317851 |
| Molecular Formula | C28H27ClN4O2S |
| Molecular Weight | 519.07 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-[[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]prop-2-enamide |
| SMILES | Cc1ccccc1C(=O)N1CCN(c2ccc(NC(=S)NC(=O)/C=C/c3ccc(Cl)cc3)cc2)CC1 |
| InChI | InChI=1S/C28H27ClN4O2S/c1-20-4-2-3-5-25(20)27(35)33-18-16-32(17-19-33)24-13-11-23(12-14-24)30-28(36)31-26(34)15-8-21-6-9-22(29)10-7-21/h2-15H,16-19H2,1H3,(H2,30,31,34,36)/b15-8+ |
| InChIKey | GJHONEFABPJZDS-OVCLIPMQSA-N |
| XLogP | 5.14 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.07 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|