C31H34N4O2S — CID 17317826
(E)-N-[[4-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 17317826) has the molecular formula C31H34N4O2S and a molecular weight of 526.71 g/mol. Its IUPAC name is (E)-N-[[4-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[[4-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17317826 |
| Molecular Formula | C31H34N4O2S |
| Molecular Weight | 526.71 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | (E)-N-[[4-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(C(=O)N2CCN(c3ccc(NC(=S)NC(=O)/C=C/c4ccc(C(C)C)cc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C31H34N4O2S/c1-22(2)25-11-6-24(7-12-25)8-17-29(36)33-31(38)32-27-13-15-28(16-14-27)34-18-20-35(21-19-34)30(37)26-9-4-23(3)5-10-26/h4-17,22H,18-21H2,1-3H3,(H2,32,33,36,38)/b17-8+ |
| InChIKey | FPZKFBJCGLWRMX-CAOOACKPSA-N |
| XLogP | 5.61 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.71 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|