C25H29ClN4O2S — CID 17334425
(E)-3-(4-chlorophenyl)-N-[[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]carbamothioyl]prop-2-enamide (PubChem CID 17334425) has the molecular formula C25H29ClN4O2S and a molecular weight of 485.05 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-[[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-[[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17334425 |
| Molecular Formula | C25H29ClN4O2S |
| Molecular Weight | 485.05 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-[[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]carbamothioyl]prop-2-enamide |
| SMILES | CC(C)CC(=O)N1CCN(c2ccc(NC(=S)NC(=O)/C=C/c3ccc(Cl)cc3)cc2)CC1 |
| InChI | InChI=1S/C25H29ClN4O2S/c1-18(2)17-24(32)30-15-13-29(14-16-30)22-10-8-21(9-11-22)27-25(33)28-23(31)12-5-19-3-6-20(26)7-4-19/h3-12,18H,13-17H2,1-2H3,(H2,27,28,31,33)/b12-5+ |
| InChIKey | WNMPDVCUWYRJCJ-LFYBBSHMSA-N |
| XLogP | 4.56 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.05 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|