C24H28Cl2N4O3S — CID 17334288
3,5-dichloro-4-methoxy-N-[[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide (PubChem CID 17334288) has the molecular formula C24H28Cl2N4O3S and a molecular weight of 523.49 g/mol. Its IUPAC name is 3,5-dichloro-4-methoxy-N-[[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide.
| Compound Name | 3,5-dichloro-4-methoxy-N-[[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17334288 |
| Molecular Formula | C24H28Cl2N4O3S |
| Molecular Weight | 523.49 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | 3,5-dichloro-4-methoxy-N-[[4-[4-(3-methylbutanoyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide |
| SMILES | COc1c(Cl)cc(C(=O)NC(=S)Nc2ccc(N3CCN(C(=O)CC(C)C)CC3)cc2)cc1Cl |
| InChI | InChI=1S/C24H28Cl2N4O3S/c1-15(2)12-21(31)30-10-8-29(9-11-30)18-6-4-17(5-7-18)27-24(34)28-23(32)16-13-19(25)22(33-3)20(26)14-16/h4-7,13-15H,8-12H2,1-3H3,(H2,27,28,32,34) |
| InChIKey | OTPWDPATAIXYQS-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|