C24H22Cl2N4O3S2 — CID 17317932
3,5-dichloro-4-methoxy-N-[[4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide (PubChem CID 17317932) has the molecular formula C24H22Cl2N4O3S2 and a molecular weight of 549.51 g/mol. Its IUPAC name is 3,5-dichloro-4-methoxy-N-[[4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide.
| Compound Name | 3,5-dichloro-4-methoxy-N-[[4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17317932 |
| Molecular Formula | C24H22Cl2N4O3S2 |
| Molecular Weight | 549.51 g/mol |
| Exact Mass | 548.05 |
| IUPAC Name | 3,5-dichloro-4-methoxy-N-[[4-[4-(thiophene-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide |
| SMILES | COc1c(Cl)cc(C(=O)NC(=S)Nc2ccc(N3CCN(C(=O)c4cccs4)CC3)cc2)cc1Cl |
| InChI | InChI=1S/C24H22Cl2N4O3S2/c1-33-21-18(25)13-15(14-19(21)26)22(31)28-24(34)27-16-4-6-17(7-5-16)29-8-10-30(11-9-29)23(32)20-3-2-12-35-20/h2-7,12-14H,8-11H2,1H3,(H2,27,28,31,34) |
| InChIKey | WAPKEMWXNLBGBW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.51 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|