C17H20N4OS2 — CID 4508683
N-[[4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]thiophene-2-carboxamide (PubChem CID 4508683) has the molecular formula C17H20N4OS2 and a molecular weight of 360.51 g/mol. Its IUPAC name is N-[[4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]thiophene-2-carboxamide.
| Compound Name | N-[[4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 4508683 |
| Molecular Formula | C17H20N4OS2 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | N-[[4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]thiophene-2-carboxamide |
| SMILES | CN1CCN(c2ccc(NC(=S)NC(=O)c3cccs3)cc2)CC1 |
| InChI | InChI=1S/C17H20N4OS2/c1-20-8-10-21(11-9-20)14-6-4-13(5-7-14)18-17(23)19-16(22)15-3-2-12-24-15/h2-7,12H,8-11H2,1H3,(H2,18,19,22,23) |
| InChIKey | GLDLYLGQYNJZPY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|