C19H20Cl2N4OS — CID 4508991
2,3-dichloro-N-[[4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]benzamide (PubChem CID 4508991) has the molecular formula C19H20Cl2N4OS and a molecular weight of 423.37 g/mol. Its IUPAC name is 2,3-dichloro-N-[[4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 2,3-dichloro-N-[[4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4508991 |
| Molecular Formula | C19H20Cl2N4OS |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 2,3-dichloro-N-[[4-(4-methylpiperazin-1-yl)phenyl]carbamothioyl]benzamide |
| SMILES | CN1CCN(c2ccc(NC(=S)NC(=O)c3cccc(Cl)c3Cl)cc2)CC1 |
| InChI | InChI=1S/C19H20Cl2N4OS/c1-24-9-11-25(12-10-24)14-7-5-13(6-8-14)22-19(27)23-18(26)15-3-2-4-16(20)17(15)21/h2-8H,9-12H2,1H3,(H2,22,23,26,27) |
| InChIKey | QRFMNCAGZJOZKU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|