C19H19Cl2N3OS — CID 4503106
2,3-dichloro-N-[(2-piperidin-1-ylphenyl)carbamothioyl]benzamide (PubChem CID 4503106) has the molecular formula C19H19Cl2N3OS and a molecular weight of 408.35 g/mol. Its IUPAC name is 2,3-dichloro-N-[(2-piperidin-1-ylphenyl)carbamothioyl]benzamide.
| Compound Name | 2,3-dichloro-N-[(2-piperidin-1-ylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4503106 |
| Molecular Formula | C19H19Cl2N3OS |
| Molecular Weight | 408.35 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | 2,3-dichloro-N-[(2-piperidin-1-ylphenyl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccccc1N1CCCCC1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C19H19Cl2N3OS/c20-14-8-6-7-13(17(14)21)18(25)23-19(26)22-15-9-2-3-10-16(15)24-11-4-1-5-12-24/h2-3,6-10H,1,4-5,11-12H2,(H2,22,23,25,26) |
| InChIKey | VOPUYCVMJRAPRN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.35 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|