C18H19IN2O — CID 1308785
2-iodo-N-(2-piperidin-1-ylphenyl)benzamide (PubChem CID 1308785) has the molecular formula C18H19IN2O and a molecular weight of 406.27 g/mol. Its IUPAC name is 2-iodo-N-(2-piperidin-1-ylphenyl)benzamide.
| Compound Name | 2-iodo-N-(2-piperidin-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 1308785 |
| Molecular Formula | C18H19IN2O |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 2-iodo-N-(2-piperidin-1-ylphenyl)benzamide |
| SMILES | O=C(Nc1ccccc1N1CCCCC1)c1ccccc1I |
| InChI | InChI=1S/C18H19IN2O/c19-15-9-3-2-8-14(15)18(22)20-16-10-4-5-11-17(16)21-12-6-1-7-13-21/h2-5,8-11H,1,6-7,12-13H2,(H,20,22) |
| InChIKey | MAZBHGWAZFQNDU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|