C17H16ClIN2O — CID 1220386
N-(3-chloro-4-pyrrolidin-1-ylphenyl)-2-iodobenzamide (PubChem CID 1220386) has the molecular formula C17H16ClIN2O and a molecular weight of 426.69 g/mol. Its IUPAC name is N-(3-chloro-4-pyrrolidin-1-ylphenyl)-2-iodobenzamide.
| Compound Name | N-(3-chloro-4-pyrrolidin-1-ylphenyl)-2-iodobenzamide |
|---|---|
| PubChem CID | 1220386 |
| Molecular Formula | C17H16ClIN2O |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.00 |
| IUPAC Name | N-(3-chloro-4-pyrrolidin-1-ylphenyl)-2-iodobenzamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)c(Cl)c1)c1ccccc1I |
| InChI | InChI=1S/C17H16ClIN2O/c18-14-11-12(7-8-16(14)21-9-3-4-10-21)20-17(22)13-5-1-2-6-15(13)19/h1-2,5-8,11H,3-4,9-10H2,(H,20,22) |
| InChIKey | IZMHDPDILQVZFL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|