C20H21Cl2N3OS — CID 2219034
2-chloro-N-[(3-chloro-2-piperidin-1-ylphenyl)carbamothioyl]-4-methylbenzamide (PubChem CID 2219034) has the molecular formula C20H21Cl2N3OS and a molecular weight of 422.38 g/mol. Its IUPAC name is 2-chloro-N-[(3-chloro-2-piperidin-1-ylphenyl)carbamothioyl]-4-methylbenzamide.
| Compound Name | 2-chloro-N-[(3-chloro-2-piperidin-1-ylphenyl)carbamothioyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 2219034 |
| Molecular Formula | C20H21Cl2N3OS |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 2-chloro-N-[(3-chloro-2-piperidin-1-ylphenyl)carbamothioyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2cccc(Cl)c2N2CCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C20H21Cl2N3OS/c1-13-8-9-14(16(22)12-13)19(26)24-20(27)23-17-7-5-6-15(21)18(17)25-10-3-2-4-11-25/h5-9,12H,2-4,10-11H2,1H3,(H2,23,24,26,27) |
| InChIKey | QNQOIYCGIBBQFW-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|