C26H23Cl3N4O2S — CID 43914018
2,5-dichloro-N-[[3-chloro-2-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide (PubChem CID 43914018) has the molecular formula C26H23Cl3N4O2S and a molecular weight of 561.92 g/mol. Its IUPAC name is 2,5-dichloro-N-[[3-chloro-2-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide.
| Compound Name | 2,5-dichloro-N-[[3-chloro-2-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 43914018 |
| Molecular Formula | C26H23Cl3N4O2S |
| Molecular Weight | 561.92 g/mol |
| Exact Mass | 560.06 |
| IUPAC Name | 2,5-dichloro-N-[[3-chloro-2-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]carbamothioyl]benzamide |
| SMILES | Cc1ccc(C(=O)N2CCN(c3c(Cl)cccc3NC(=S)NC(=O)c3cc(Cl)ccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C26H23Cl3N4O2S/c1-16-5-7-17(8-6-16)25(35)33-13-11-32(12-14-33)23-21(29)3-2-4-22(23)30-26(36)31-24(34)19-15-18(27)9-10-20(19)28/h2-10,15H,11-14H2,1H3,(H2,30,31,34,36) |
| InChIKey | QKNIPVYXLCZDSP-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.92 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|