C20H22ClN3OS — CID 5252779
N-[(3-chloro-2-pyrrolidin-1-ylphenyl)carbamothioyl]-3,4-dimethylbenzamide (PubChem CID 5252779) has the molecular formula C20H22ClN3OS and a molecular weight of 387.94 g/mol. Its IUPAC name is N-[(3-chloro-2-pyrrolidin-1-ylphenyl)carbamothioyl]-3,4-dimethylbenzamide.
| Compound Name | N-[(3-chloro-2-pyrrolidin-1-ylphenyl)carbamothioyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 5252779 |
| Molecular Formula | C20H22ClN3OS |
| Molecular Weight | 387.94 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | N-[(3-chloro-2-pyrrolidin-1-ylphenyl)carbamothioyl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2cccc(Cl)c2N2CCCC2)cc1C |
| InChI | InChI=1S/C20H22ClN3OS/c1-13-8-9-15(12-14(13)2)19(25)23-20(26)22-17-7-5-6-16(21)18(17)24-10-3-4-11-24/h5-9,12H,3-4,10-11H2,1-2H3,(H2,22,23,25,26) |
| InChIKey | HTRKFCRJNOYJTQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.94 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|