C20H22BrClN4OS — CID 4566183
4-bromo-N-[[3-chloro-2-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]benzamide (PubChem CID 4566183) has the molecular formula C20H22BrClN4OS and a molecular weight of 481.85 g/mol. Its IUPAC name is 4-bromo-N-[[3-chloro-2-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 4-bromo-N-[[3-chloro-2-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4566183 |
| Molecular Formula | C20H22BrClN4OS |
| Molecular Weight | 481.85 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | 4-bromo-N-[[3-chloro-2-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]benzamide |
| SMILES | CCN1CCN(c2c(Cl)cccc2NC(=S)NC(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C20H22BrClN4OS/c1-2-25-10-12-26(13-11-25)18-16(22)4-3-5-17(18)23-20(28)24-19(27)14-6-8-15(21)9-7-14/h3-9H,2,10-13H2,1H3,(H2,23,24,27,28) |
| InChIKey | CTWGZAPAPQPESU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.85 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|