C19H18Cl3N3OS — CID 4030604
3,4-dichloro-N-[(3-chloro-2-piperidin-1-ylphenyl)carbamothioyl]benzamide (PubChem CID 4030604) has the molecular formula C19H18Cl3N3OS and a molecular weight of 442.80 g/mol. Its IUPAC name is 3,4-dichloro-N-[(3-chloro-2-piperidin-1-ylphenyl)carbamothioyl]benzamide.
| Compound Name | 3,4-dichloro-N-[(3-chloro-2-piperidin-1-ylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4030604 |
| Molecular Formula | C19H18Cl3N3OS |
| Molecular Weight | 442.80 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | 3,4-dichloro-N-[(3-chloro-2-piperidin-1-ylphenyl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1cccc(Cl)c1N1CCCCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H18Cl3N3OS/c20-13-8-7-12(11-15(13)22)18(26)24-19(27)23-16-6-4-5-14(21)17(16)25-9-2-1-3-10-25/h4-8,11H,1-3,9-10H2,(H2,23,24,26,27) |
| InChIKey | ILCVGMITKZODED-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.80 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|