C17H15Cl3N2O2 — CID 3478748
3,4-dichloro-N-(3-chloro-2-morpholin-4-ylphenyl)benzamide (PubChem CID 3478748) has the molecular formula C17H15Cl3N2O2 and a molecular weight of 385.68 g/mol. Its IUPAC name is 3,4-dichloro-N-(3-chloro-2-morpholin-4-ylphenyl)benzamide.
| Compound Name | 3,4-dichloro-N-(3-chloro-2-morpholin-4-ylphenyl)benzamide |
|---|---|
| PubChem CID | 3478748 |
| Molecular Formula | C17H15Cl3N2O2 |
| Molecular Weight | 385.68 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | 3,4-dichloro-N-(3-chloro-2-morpholin-4-ylphenyl)benzamide |
| SMILES | O=C(Nc1cccc(Cl)c1N1CCOCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H15Cl3N2O2/c18-12-5-4-11(10-14(12)20)17(23)21-15-3-1-2-13(19)16(15)22-6-8-24-9-7-22/h1-5,10H,6-9H2,(H,21,23) |
| InChIKey | QXEIHIQKNFRRFQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.68 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |